C20H26N4O2 — CID 167796218
(E)-1-[(2S,4S)-2-[(3-aminopyrazol-1-yl)methyl]-4-methoxypyrrolidin-1-yl]-3-(2-methylphenyl)but-2-en-1-one (PubChem CID 167796218) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is (E)-1-[(2S,4S)-2-[(3-aminopyrazol-1-yl)methyl]-4-methoxypyrrolidin-1-yl]-3-(2-methylphenyl)but-2-en-1-one.
| Compound Name | (E)-1-[(2S,4S)-2-[(3-aminopyrazol-1-yl)methyl]-4-methoxypyrrolidin-1-yl]-3-(2-methylphenyl)but-2-en-1-one |
|---|---|
| PubChem CID | 167796218 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (E)-1-[(2S,4S)-2-[(3-aminopyrazol-1-yl)methyl]-4-methoxypyrrolidin-1-yl]-3-(2-methylphenyl)but-2-en-1-one |
| SMILES | CO[C@H]1C[C@@H](Cn2ccc(N)n2)N(C(=O)/C=C(\C)c2ccccc2C)C1 |
| InChI | InChI=1S/C20H26N4O2/c1-14-6-4-5-7-18(14)15(2)10-20(25)24-13-17(26-3)11-16(24)12-23-9-8-19(21)22-23/h4-10,16-17H,11-13H2,1-3H3,(H2,21,22)/b15-10+/t16-,17-/m0/s1 |
| InChIKey | OSAVURACFPMLRP-DAPLNWGVSA-N |
| XLogP | 2.49 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|