C14H21FN4O2 — CID 167893486
1-[(2S,4R)-2-[(3-aminopyrazol-1-yl)methyl]-4-methoxypyrrolidin-1-yl]-2-fluoro-3-methylbut-2-en-1-one (PubChem CID 167893486) has the molecular formula C14H21FN4O2 and a molecular weight of 296.35 g/mol. Its IUPAC name is 1-[(2S,4R)-2-[(3-aminopyrazol-1-yl)methyl]-4-methoxypyrrolidin-1-yl]-2-fluoro-3-methylbut-2-en-1-one.
| Compound Name | 1-[(2S,4R)-2-[(3-aminopyrazol-1-yl)methyl]-4-methoxypyrrolidin-1-yl]-2-fluoro-3-methylbut-2-en-1-one |
|---|---|
| PubChem CID | 167893486 |
| Molecular Formula | C14H21FN4O2 |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 1-[(2S,4R)-2-[(3-aminopyrazol-1-yl)methyl]-4-methoxypyrrolidin-1-yl]-2-fluoro-3-methylbut-2-en-1-one |
| SMILES | CO[C@@H]1C[C@@H](Cn2ccc(N)n2)N(C(=O)C(F)=C(C)C)C1 |
| InChI | InChI=1S/C14H21FN4O2/c1-9(2)13(15)14(20)19-8-11(21-3)6-10(19)7-18-5-4-12(16)17-18/h4-5,10-11H,6-8H2,1-3H3,(H2,16,17)/t10-,11+/m0/s1 |
| InChIKey | RXTDCGLAQFPUCS-WDEREUQCSA-N |
| XLogP | 1.34 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|