C15H25N3O4S — CID 167796603
9-hydroxy-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylazecan-4-one (PubChem CID 167796603) has the molecular formula C15H25N3O4S and a molecular weight of 343.45 g/mol. Its IUPAC name is 9-hydroxy-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylazecan-4-one.
| Compound Name | 9-hydroxy-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylazecan-4-one |
|---|---|
| PubChem CID | 167796603 |
| Molecular Formula | C15H25N3O4S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 9-hydroxy-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylazecan-4-one |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)N1CCC(=O)CCCCC(O)C1 |
| InChI | InChI=1S/C15H25N3O4S/c1-11-15(12(2)17(3)16-11)23(21,22)18-9-8-13(19)6-4-5-7-14(20)10-18/h14,20H,4-10H2,1-3H3 |
| InChIKey | LHJVFTXTVLMCSI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |