C18H22N2O4S2 — CID 167796937
4-[(1-benzyl-2-methylpyrrolidin-3-yl)sulfamoyl]-5-methylthiophene-2-carboxylic acid (PubChem CID 167796937) has the molecular formula C18H22N2O4S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 4-[(1-benzyl-2-methylpyrrolidin-3-yl)sulfamoyl]-5-methylthiophene-2-carboxylic acid.
| Compound Name | 4-[(1-benzyl-2-methylpyrrolidin-3-yl)sulfamoyl]-5-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 167796937 |
| Molecular Formula | C18H22N2O4S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 4-[(1-benzyl-2-methylpyrrolidin-3-yl)sulfamoyl]-5-methylthiophene-2-carboxylic acid |
| SMILES | Cc1sc(C(=O)O)cc1S(=O)(=O)NC1CCN(Cc2ccccc2)C1C |
| InChI | InChI=1S/C18H22N2O4S2/c1-12-15(8-9-20(12)11-14-6-4-3-5-7-14)19-26(23,24)17-10-16(18(21)22)25-13(17)2/h3-7,10,12,15,19H,8-9,11H2,1-2H3,(H,21,22) |
| InChIKey | JTUZFEBYMIWGHH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |