C20H23NO4 — CID 167797466
4-(1,3-diphenylpropylamino)-3-(hydroxymethyl)-4-oxobutanoic acid (PubChem CID 167797466) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-(1,3-diphenylpropylamino)-3-(hydroxymethyl)-4-oxobutanoic acid.
| Compound Name | 4-(1,3-diphenylpropylamino)-3-(hydroxymethyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 167797466 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 4-(1,3-diphenylpropylamino)-3-(hydroxymethyl)-4-oxobutanoic acid |
| SMILES | O=C(O)CC(CO)C(=O)NC(CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H23NO4/c22-14-17(13-19(23)24)20(25)21-18(16-9-5-2-6-10-16)12-11-15-7-3-1-4-8-15/h1-10,17-18,22H,11-14H2,(H,21,25)(H,23,24) |
| InChIKey | AZUALFFEPGREMW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |