C12H18F2N2O3S — CID 167799258
1-cyclobutyl-3-[2-(2,2-difluoroethoxy)ethylsulfonylmethyl]pyrazole (PubChem CID 167799258) has the molecular formula C12H18F2N2O3S and a molecular weight of 308.35 g/mol. Its IUPAC name is 1-cyclobutyl-3-[2-(2,2-difluoroethoxy)ethylsulfonylmethyl]pyrazole.
| Compound Name | 1-cyclobutyl-3-[2-(2,2-difluoroethoxy)ethylsulfonylmethyl]pyrazole |
|---|---|
| PubChem CID | 167799258 |
| Molecular Formula | C12H18F2N2O3S |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-cyclobutyl-3-[2-(2,2-difluoroethoxy)ethylsulfonylmethyl]pyrazole |
| SMILES | O=S(=O)(CCOCC(F)F)Cc1ccn(C2CCC2)n1 |
| InChI | InChI=1S/C12H18F2N2O3S/c13-12(14)8-19-6-7-20(17,18)9-10-4-5-16(15-10)11-2-1-3-11/h4-5,11-12H,1-3,6-9H2 |
| InChIKey | JQQWGFBAJOIZFU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|