C25H28N4S — CID 167801472
5-[[prop-2-ynyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine (PubChem CID 167801472) has the molecular formula C25H28N4S and a molecular weight of 416.59 g/mol. Its IUPAC name is 5-[[prop-2-ynyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | 5-[[prop-2-ynyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 167801472 |
| Molecular Formula | C25H28N4S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 5-[[prop-2-ynyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine |
| SMILES | C#CCN(Cc1nc(N)c2c3c(sc2n1)CCCCC3)C1CCCc2ccccc21 |
| InChI | InChI=1S/C25H28N4S/c1-2-15-29(20-13-8-10-17-9-6-7-11-18(17)20)16-22-27-24(26)23-19-12-4-3-5-14-21(19)30-25(23)28-22/h1,6-7,9,11,20H,3-5,8,10,12-16H2,(H2,26,27,28) |
| InChIKey | JFIXOBNEUIMCHT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|