C26H35N5O — CID 167802123
1-[4-[[3-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]quinoxalin-2-yl]amino]cyclohexyl]piperidin-2-one (PubChem CID 167802123) has the molecular formula C26H35N5O and a molecular weight of 433.60 g/mol. Its IUPAC name is 1-[4-[[3-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]quinoxalin-2-yl]amino]cyclohexyl]piperidin-2-one.
| Compound Name | 1-[4-[[3-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]quinoxalin-2-yl]amino]cyclohexyl]piperidin-2-one |
|---|---|
| PubChem CID | 167802123 |
| Molecular Formula | C26H35N5O |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | 1-[4-[[3-[(3aS,6aR)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]quinoxalin-2-yl]amino]cyclohexyl]piperidin-2-one |
| SMILES | O=C1CCCCN1C1CCC(Nc2nc3ccccc3nc2N2C[C@H]3CCC[C@H]3C2)CC1 |
| InChI | InChI=1S/C26H35N5O/c32-24-10-3-4-15-31(24)21-13-11-20(12-14-21)27-25-26(29-23-9-2-1-8-22(23)28-25)30-16-18-6-5-7-19(18)17-30/h1-2,8-9,18-21H,3-7,10-17H2,(H,27,28)/t18-,19+,20?,21? |
| InChIKey | QRBXASMFOMXVPS-WHSGIHJSSA-N |
| XLogP | 4.60 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |