C20H27N5O — CID 167802192
(2,3a,6a-trimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl)-[1-(2-phenylethyl)triazol-4-yl]methanone (PubChem CID 167802192) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is (2,3a,6a-trimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl)-[1-(2-phenylethyl)triazol-4-yl]methanone.
| Compound Name | (2,3a,6a-trimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl)-[1-(2-phenylethyl)triazol-4-yl]methanone |
|---|---|
| PubChem CID | 167802192 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | (2,3a,6a-trimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl)-[1-(2-phenylethyl)triazol-4-yl]methanone |
| SMILES | CN1CC2(C)CN(C(=O)c3cn(CCc4ccccc4)nn3)CC2(C)C1 |
| InChI | InChI=1S/C20H27N5O/c1-19-12-23(3)13-20(19,2)15-24(14-19)18(26)17-11-25(22-21-17)10-9-16-7-5-4-6-8-16/h4-8,11H,9-10,12-15H2,1-3H3 |
| InChIKey | DYXQZGDXJCTNFE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |