C18H15FN2O3 — CID 167803421
N-(1,3-benzodioxol-5-yl)-2-(6-fluoro-1H-indol-3-yl)-N-methylacetamide (PubChem CID 167803421) has the molecular formula C18H15FN2O3 and a molecular weight of 326.33 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(6-fluoro-1H-indol-3-yl)-N-methylacetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(6-fluoro-1H-indol-3-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 167803421 |
| Molecular Formula | C18H15FN2O3 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(6-fluoro-1H-indol-3-yl)-N-methylacetamide |
| SMILES | CN(C(=O)Cc1c[nH]c2cc(F)ccc12)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H15FN2O3/c1-21(13-3-5-16-17(8-13)24-10-23-16)18(22)6-11-9-20-15-7-12(19)2-4-14(11)15/h2-5,7-9,20H,6,10H2,1H3 |
| InChIKey | NAGKUPHLKQLNDP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |