C17H16N4O3 — CID 167803874
2-[2-oxo-3-(2-quinolin-6-ylethylamino)pyrazin-1-yl]acetic acid (PubChem CID 167803874) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 2-[2-oxo-3-(2-quinolin-6-ylethylamino)pyrazin-1-yl]acetic acid.
| Compound Name | 2-[2-oxo-3-(2-quinolin-6-ylethylamino)pyrazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 167803874 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 2-[2-oxo-3-(2-quinolin-6-ylethylamino)pyrazin-1-yl]acetic acid |
| SMILES | O=C(O)Cn1ccnc(NCCc2ccc3ncccc3c2)c1=O |
| InChI | InChI=1S/C17H16N4O3/c22-15(23)11-21-9-8-20-16(17(21)24)19-7-5-12-3-4-14-13(10-12)2-1-6-18-14/h1-4,6,8-10H,5,7,11H2,(H,19,20)(H,22,23) |
| InChIKey | MKTIVLKQGUGPPG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |