C18H22F4N2O2 — CID 167804141
1-[(3S)-3-butyl-4-[3-fluoro-5-(trifluoromethyl)benzoyl]piperazin-1-yl]ethanone (PubChem CID 167804141) has the molecular formula C18H22F4N2O2 and a molecular weight of 374.38 g/mol. Its IUPAC name is 1-[(3S)-3-butyl-4-[3-fluoro-5-(trifluoromethyl)benzoyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[(3S)-3-butyl-4-[3-fluoro-5-(trifluoromethyl)benzoyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 167804141 |
| Molecular Formula | C18H22F4N2O2 |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 1-[(3S)-3-butyl-4-[3-fluoro-5-(trifluoromethyl)benzoyl]piperazin-1-yl]ethanone |
| SMILES | CCCC[C@H]1CN(C(C)=O)CCN1C(=O)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H22F4N2O2/c1-3-4-5-16-11-23(12(2)25)6-7-24(16)17(26)13-8-14(18(20,21)22)10-15(19)9-13/h8-10,16H,3-7,11H2,1-2H3/t16-/m0/s1 |
| InChIKey | YAQHPRWIHCEBGZ-INIZCTEOSA-N |
| XLogP | 3.71 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |