C38H33ClN6O5S — CID 167804981
[2-[[3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl] 5-(2-chlorophenyl)-1-phenylpyrazole-3-carboxylate (PubChem CID 167804981) has the molecular formula C38H33ClN6O5S and a molecular weight of 721.24 g/mol. Its IUPAC name is [2-[[3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl] 5-(2-chlorophenyl)-1-phenylpyrazole-3-carboxylate.
| Compound Name | [2-[[3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl] 5-(2-chlorophenyl)-1-phenylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 167804981 |
| Molecular Formula | C38H33ClN6O5S |
| Molecular Weight | 721.24 g/mol |
| Exact Mass | 720.19 |
| IUPAC Name | [2-[[3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]-2-oxoethyl] 5-(2-chlorophenyl)-1-phenylpyrazole-3-carboxylate |
| SMILES | Cc1c(NC(=O)c2c(NC(=O)COC(=O)c3cc(-c4ccccc4Cl)n(-c4ccccc4)n3)sc3c2CCCC3)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C38H33ClN6O5S/c1-23-34(37(48)45(43(23)2)25-15-7-4-8-16-25)41-35(47)33-27-18-10-12-20-31(27)51-36(33)40-32(46)22-50-38(49)29-21-30(26-17-9-11-19-28(26)39)44(42-29)24-13-5-3-6-14-24/h3-9,11,13-17,19,21H,10,12,18,20,22H2,1-2H3,(H,40,46)(H,41,47) |
| InChIKey | LUCHDIWGNCKTPG-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.24 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |