C21H28N4O3 — CID 167805269
1-[5-(2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-yl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea (PubChem CID 167805269) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-[5-(2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-yl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea.
| Compound Name | 1-[5-(2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-yl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 167805269 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 1-[5-(2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazol-3-yl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
| SMILES | CC1(C)CC(NC(=O)Nc2cc(-c3ccc4c(c3)CCO4)on2)CC(C)(C)N1 |
| InChI | InChI=1S/C21H28N4O3/c1-20(2)11-15(12-21(3,4)25-20)22-19(26)23-18-10-17(28-24-18)13-5-6-16-14(9-13)7-8-27-16/h5-6,9-10,15,25H,7-8,11-12H2,1-4H3,(H2,22,23,24,26) |
| InChIKey | GXBKOKCFFLHEJJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |