C12H16F2N4O2 — CID 167805385
N-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-1-methyl-2-oxopiperidine-4-carboxamide (PubChem CID 167805385) has the molecular formula C12H16F2N4O2 and a molecular weight of 286.28 g/mol. Its IUPAC name is N-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-1-methyl-2-oxopiperidine-4-carboxamide.
| Compound Name | N-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-1-methyl-2-oxopiperidine-4-carboxamide |
|---|---|
| PubChem CID | 167805385 |
| Molecular Formula | C12H16F2N4O2 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | N-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-1-methyl-2-oxopiperidine-4-carboxamide |
| SMILES | CN1CCC(C(=O)Nc2cn(C)nc2C(F)F)CC1=O |
| InChI | InChI=1S/C12H16F2N4O2/c1-17-4-3-7(5-9(17)19)12(20)15-8-6-18(2)16-10(8)11(13)14/h6-7,11H,3-5H2,1-2H3,(H,15,20) |
| InChIKey | LIAHGRZFHHBBOS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |