C13H20F2N4O2S — CID 146103717
1-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-3-[2-(thian-4-yloxy)ethyl]urea (PubChem CID 146103717) has the molecular formula C13H20F2N4O2S and a molecular weight of 334.39 g/mol. Its IUPAC name is 1-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-3-[2-(thian-4-yloxy)ethyl]urea.
| Compound Name | 1-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-3-[2-(thian-4-yloxy)ethyl]urea |
|---|---|
| PubChem CID | 146103717 |
| Molecular Formula | C13H20F2N4O2S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 1-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-3-[2-(thian-4-yloxy)ethyl]urea |
| SMILES | Cn1cc(NC(=O)NCCOC2CCSCC2)c(C(F)F)n1 |
| InChI | InChI=1S/C13H20F2N4O2S/c1-19-8-10(11(18-19)12(14)15)17-13(20)16-4-5-21-9-2-6-22-7-3-9/h8-9,12H,2-7H2,1H3,(H2,16,17,20) |
| InChIKey | NVAAHTRACPXZRF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|