C11H18N4OS — CID 99828736
1-(1,3-dimethylpyrazol-4-yl)-3-(thian-4-yl)urea (PubChem CID 99828736) has the molecular formula C11H18N4OS and a molecular weight of 254.36 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazol-4-yl)-3-(thian-4-yl)urea.
| Compound Name | 1-(1,3-dimethylpyrazol-4-yl)-3-(thian-4-yl)urea |
|---|---|
| PubChem CID | 99828736 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-(1,3-dimethylpyrazol-4-yl)-3-(thian-4-yl)urea |
| SMILES | Cc1nn(C)cc1NC(=O)NC1CCSCC1 |
| InChI | InChI=1S/C11H18N4OS/c1-8-10(7-15(2)14-8)13-11(16)12-9-3-5-17-6-4-9/h7,9H,3-6H2,1-2H3,(H2,12,13,16) |
| InChIKey | QNJIUSFLRBPNOY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |