C17H21N5O — CID 167807379
3-ethenyl-N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]piperidine-1-carboxamide (PubChem CID 167807379) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is 3-ethenyl-N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]piperidine-1-carboxamide.
| Compound Name | 3-ethenyl-N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 167807379 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 3-ethenyl-N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]piperidine-1-carboxamide |
| SMILES | C=CC1CCCN(C(=O)Nc2ccccc2Cn2cncn2)C1 |
| InChI | InChI=1S/C17H21N5O/c1-2-14-6-5-9-21(10-14)17(23)20-16-8-4-3-7-15(16)11-22-13-18-12-19-22/h2-4,7-8,12-14H,1,5-6,9-11H2,(H,20,23) |
| InChIKey | DOKKKGJTYNMGBY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|