C16H22N4O — CID 124846633
(2S)-2-methyl-N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]hexanamide (PubChem CID 124846633) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is (2S)-2-methyl-N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]hexanamide.
| Compound Name | (2S)-2-methyl-N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]hexanamide |
|---|---|
| PubChem CID | 124846633 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (2S)-2-methyl-N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]hexanamide |
| SMILES | CCCC[C@H](C)C(=O)Nc1ccccc1Cn1cncn1 |
| InChI | InChI=1S/C16H22N4O/c1-3-4-7-13(2)16(21)19-15-9-6-5-8-14(15)10-20-12-17-11-18-20/h5-6,8-9,11-13H,3-4,7,10H2,1-2H3,(H,19,21)/t13-/m0/s1 |
| InChIKey | JBNKPCQNFIMRSC-ZDUSSCGKSA-N |
| XLogP | 3.09 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |