C14H21F2N3O — CID 16780971
1-[2-(difluoromethoxy)phenyl]-2-(4-methylpiperazin-1-yl)ethanamine (PubChem CID 16780971) has the molecular formula C14H21F2N3O and a molecular weight of 285.34 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)phenyl]-2-(4-methylpiperazin-1-yl)ethanamine.
| Compound Name | 1-[2-(difluoromethoxy)phenyl]-2-(4-methylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 16780971 |
| Molecular Formula | C14H21F2N3O |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-[2-(difluoromethoxy)phenyl]-2-(4-methylpiperazin-1-yl)ethanamine |
| SMILES | CN1CCN(CC(N)c2ccccc2OC(F)F)CC1 |
| InChI | InChI=1S/C14H21F2N3O/c1-18-6-8-19(9-7-18)10-12(17)11-4-2-3-5-13(11)20-14(15)16/h2-5,12,14H,6-10,17H2,1H3 |
| InChIKey | AWLJPTVZJWODFZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |