C16H16ClN3O3 — CID 167809717
1-[[4-(3-chlorophenoxy)-2-pyridinyl]methyl]-3-(oxetan-3-yl)urea (PubChem CID 167809717) has the molecular formula C16H16ClN3O3 and a molecular weight of 333.78 g/mol. Its IUPAC name is 1-[[4-(3-chlorophenoxy)-2-pyridinyl]methyl]-3-(oxetan-3-yl)urea.
| Compound Name | 1-[[4-(3-chlorophenoxy)-2-pyridinyl]methyl]-3-(oxetan-3-yl)urea |
|---|---|
| PubChem CID | 167809717 |
| Molecular Formula | C16H16ClN3O3 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 1-[[4-(3-chlorophenoxy)-2-pyridinyl]methyl]-3-(oxetan-3-yl)urea |
| SMILES | O=C(NCc1cc(Oc2cccc(Cl)c2)ccn1)NC1COC1 |
| InChI | InChI=1S/C16H16ClN3O3/c17-11-2-1-3-14(6-11)23-15-4-5-18-12(7-15)8-19-16(21)20-13-9-22-10-13/h1-7,13H,8-10H2,(H2,19,20,21) |
| InChIKey | LTZBMDNGCZTDGY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |