C23H22N4O3 — CID 167810018
4-methoxy-N-[6-(4-methylphenyl)-2-pyridinyl]-3-(2-oxoimidazolidin-1-yl)benzamide (PubChem CID 167810018) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 4-methoxy-N-[6-(4-methylphenyl)-2-pyridinyl]-3-(2-oxoimidazolidin-1-yl)benzamide.
| Compound Name | 4-methoxy-N-[6-(4-methylphenyl)-2-pyridinyl]-3-(2-oxoimidazolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 167810018 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 4-methoxy-N-[6-(4-methylphenyl)-2-pyridinyl]-3-(2-oxoimidazolidin-1-yl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(-c3ccc(C)cc3)n2)cc1N1CCNC1=O |
| InChI | InChI=1S/C23H22N4O3/c1-15-6-8-16(9-7-15)18-4-3-5-21(25-18)26-22(28)17-10-11-20(30-2)19(14-17)27-13-12-24-23(27)29/h3-11,14H,12-13H2,1-2H3,(H,24,29)(H,25,26,28) |
| InChIKey | DIDYCANFBXJLLF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |