C21H24N4O5 — CID 71873314
N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]-4-methoxy-3-(2-oxoimidazolidin-1-yl)benzamide (PubChem CID 71873314) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]-4-methoxy-3-(2-oxoimidazolidin-1-yl)benzamide.
| Compound Name | N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]-4-methoxy-3-(2-oxoimidazolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 71873314 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]-4-methoxy-3-(2-oxoimidazolidin-1-yl)benzamide |
| SMILES | CCNC(=O)COc1ccc(NC(=O)c2ccc(OC)c(N3CCNC3=O)c2)cc1 |
| InChI | InChI=1S/C21H24N4O5/c1-3-22-19(26)13-30-16-7-5-15(6-8-16)24-20(27)14-4-9-18(29-2)17(12-14)25-11-10-23-21(25)28/h4-9,12H,3,10-11,13H2,1-2H3,(H,22,26)(H,23,28)(H,24,27) |
| InChIKey | QZXGPSGEANVRNV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |