C15H14ClN5O — CID 167812323
N-(4-chloro-1H-indazol-5-yl)-2-(dimethylamino)pyridine-4-carboxamide (PubChem CID 167812323) has the molecular formula C15H14ClN5O and a molecular weight of 315.76 g/mol. Its IUPAC name is N-(4-chloro-1H-indazol-5-yl)-2-(dimethylamino)pyridine-4-carboxamide.
| Compound Name | N-(4-chloro-1H-indazol-5-yl)-2-(dimethylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 167812323 |
| Molecular Formula | C15H14ClN5O |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N-(4-chloro-1H-indazol-5-yl)-2-(dimethylamino)pyridine-4-carboxamide |
| SMILES | CN(C)c1cc(C(=O)Nc2ccc3[nH]ncc3c2Cl)ccn1 |
| InChI | InChI=1S/C15H14ClN5O/c1-21(2)13-7-9(5-6-17-13)15(22)19-12-4-3-11-10(14(12)16)8-18-20-11/h3-8H,1-2H3,(H,18,20)(H,19,22) |
| InChIKey | RPRAUFJYHTUNKS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |