C13H10ClN5OS — CID 167744320
N-(4-chloro-1H-indazol-5-yl)-3-methylsulfanylpyrazine-2-carboxamide (PubChem CID 167744320) has the molecular formula C13H10ClN5OS and a molecular weight of 319.78 g/mol. Its IUPAC name is N-(4-chloro-1H-indazol-5-yl)-3-methylsulfanylpyrazine-2-carboxamide.
| Compound Name | N-(4-chloro-1H-indazol-5-yl)-3-methylsulfanylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 167744320 |
| Molecular Formula | C13H10ClN5OS |
| Molecular Weight | 319.78 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | N-(4-chloro-1H-indazol-5-yl)-3-methylsulfanylpyrazine-2-carboxamide |
| SMILES | CSc1nccnc1C(=O)Nc1ccc2[nH]ncc2c1Cl |
| InChI | InChI=1S/C13H10ClN5OS/c1-21-13-11(15-4-5-16-13)12(20)18-9-3-2-8-7(10(9)14)6-17-19-8/h2-6H,1H3,(H,17,19)(H,18,20) |
| InChIKey | LUFYAJCSAVIQFH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.78 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |