C14H19N3O2 — CID 167812895
N-[(6-methyl-1,4-oxazepan-6-yl)methyl]-1,3-benzoxazol-2-amine (PubChem CID 167812895) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-[(6-methyl-1,4-oxazepan-6-yl)methyl]-1,3-benzoxazol-2-amine.
| Compound Name | N-[(6-methyl-1,4-oxazepan-6-yl)methyl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 167812895 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-[(6-methyl-1,4-oxazepan-6-yl)methyl]-1,3-benzoxazol-2-amine |
| SMILES | CC1(CNc2nc3ccccc3o2)CNCCOC1 |
| InChI | InChI=1S/C14H19N3O2/c1-14(8-15-6-7-18-10-14)9-16-13-17-11-4-2-3-5-12(11)19-13/h2-5,15H,6-10H2,1H3,(H,16,17) |
| InChIKey | YRLAMSJNJCZTMZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |