C14H25N5O3S — CID 167813448
N-butan-2-yl-2-[(1-cyclohexyltetrazol-5-yl)methylsulfonyl]acetamide (PubChem CID 167813448) has the molecular formula C14H25N5O3S and a molecular weight of 343.45 g/mol. Its IUPAC name is N-butan-2-yl-2-[(1-cyclohexyltetrazol-5-yl)methylsulfonyl]acetamide.
| Compound Name | N-butan-2-yl-2-[(1-cyclohexyltetrazol-5-yl)methylsulfonyl]acetamide |
|---|---|
| PubChem CID | 167813448 |
| Molecular Formula | C14H25N5O3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N-butan-2-yl-2-[(1-cyclohexyltetrazol-5-yl)methylsulfonyl]acetamide |
| SMILES | CCC(C)NC(=O)CS(=O)(=O)Cc1nnnn1C1CCCCC1 |
| InChI | InChI=1S/C14H25N5O3S/c1-3-11(2)15-14(20)10-23(21,22)9-13-16-17-18-19(13)12-7-5-4-6-8-12/h11-12H,3-10H2,1-2H3,(H,15,20) |
| InChIKey | BHJDRJMBZXYUDB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |