C14H22N6O2S — CID 167879706
1-cyclohexyl-5-[(2-ethylpyrazol-3-yl)methylsulfonylmethyl]tetrazole (PubChem CID 167879706) has the molecular formula C14H22N6O2S and a molecular weight of 338.44 g/mol. Its IUPAC name is 1-cyclohexyl-5-[(2-ethylpyrazol-3-yl)methylsulfonylmethyl]tetrazole.
| Compound Name | 1-cyclohexyl-5-[(2-ethylpyrazol-3-yl)methylsulfonylmethyl]tetrazole |
|---|---|
| PubChem CID | 167879706 |
| Molecular Formula | C14H22N6O2S |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 1-cyclohexyl-5-[(2-ethylpyrazol-3-yl)methylsulfonylmethyl]tetrazole |
| SMILES | CCn1nccc1CS(=O)(=O)Cc1nnnn1C1CCCCC1 |
| InChI | InChI=1S/C14H22N6O2S/c1-2-19-13(8-9-15-19)10-23(21,22)11-14-16-17-18-20(14)12-6-4-3-5-7-12/h8-9,12H,2-7,10-11H2,1H3 |
| InChIKey | MTCNCYSDDBFXNJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 95.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |