C16H17N5O3 — CID 167816233
4-methyl-N-[4-propan-2-yloxy-3-(2H-tetrazol-5-yl)phenyl]furan-3-carboxamide (PubChem CID 167816233) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is 4-methyl-N-[4-propan-2-yloxy-3-(2H-tetrazol-5-yl)phenyl]furan-3-carboxamide.
| Compound Name | 4-methyl-N-[4-propan-2-yloxy-3-(2H-tetrazol-5-yl)phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 167816233 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 4-methyl-N-[4-propan-2-yloxy-3-(2H-tetrazol-5-yl)phenyl]furan-3-carboxamide |
| SMILES | Cc1cocc1C(=O)Nc1ccc(OC(C)C)c(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C16H17N5O3/c1-9(2)24-14-5-4-11(6-12(14)15-18-20-21-19-15)17-16(22)13-8-23-7-10(13)3/h4-9H,1-3H3,(H,17,22)(H,18,19,20,21) |
| InChIKey | FGIQIPXSOJDLTF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 105.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |