C18H21NO3S — CID 167819066
1-[[2-(benzenesulfonyl)ethylamino]methyl]-2,3-dihydroinden-1-ol (PubChem CID 167819066) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is 1-[[2-(benzenesulfonyl)ethylamino]methyl]-2,3-dihydroinden-1-ol.
| Compound Name | 1-[[2-(benzenesulfonyl)ethylamino]methyl]-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 167819066 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 1-[[2-(benzenesulfonyl)ethylamino]methyl]-2,3-dihydroinden-1-ol |
| SMILES | O=S(=O)(CCNCC1(O)CCc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C18H21NO3S/c20-18(11-10-15-6-4-5-9-17(15)18)14-19-12-13-23(21,22)16-7-2-1-3-8-16/h1-9,19-20H,10-14H2 |
| InChIKey | VJJFWAKBGCJMMK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|