C15H23N5O2 — CID 167819885
(2S)-3-[6-(3-propan-2-ylpyrrolidin-1-yl)purin-9-yl]propane-1,2-diol (PubChem CID 167819885) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is (2S)-3-[6-(3-propan-2-ylpyrrolidin-1-yl)purin-9-yl]propane-1,2-diol.
| Compound Name | (2S)-3-[6-(3-propan-2-ylpyrrolidin-1-yl)purin-9-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 167819885 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | (2S)-3-[6-(3-propan-2-ylpyrrolidin-1-yl)purin-9-yl]propane-1,2-diol |
| SMILES | CC(C)C1CCN(c2ncnc3c2ncn3C[C@H](O)CO)C1 |
| InChI | InChI=1S/C15H23N5O2/c1-10(2)11-3-4-19(5-11)14-13-15(17-8-16-14)20(9-18-13)6-12(22)7-21/h8-12,21-22H,3-7H2,1-2H3/t11?,12-/m0/s1 |
| InChIKey | RGMWFRZUWXXBKV-KIYNQFGBSA-N |
| XLogP | 0.66 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |