C16H29F2N3O3 — CID 167820474
1-N-(4,4-difluoro-2-methylbutyl)-3-N-(2-methoxyethyl)-6-methylpiperidine-1,3-dicarboxamide (PubChem CID 167820474) has the molecular formula C16H29F2N3O3 and a molecular weight of 349.42 g/mol. Its IUPAC name is 1-N-(4,4-difluoro-2-methylbutyl)-3-N-(2-methoxyethyl)-6-methylpiperidine-1,3-dicarboxamide.
| Compound Name | 1-N-(4,4-difluoro-2-methylbutyl)-3-N-(2-methoxyethyl)-6-methylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 167820474 |
| Molecular Formula | C16H29F2N3O3 |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 1-N-(4,4-difluoro-2-methylbutyl)-3-N-(2-methoxyethyl)-6-methylpiperidine-1,3-dicarboxamide |
| SMILES | COCCNC(=O)C1CCC(C)N(C(=O)NCC(C)CC(F)F)C1 |
| InChI | InChI=1S/C16H29F2N3O3/c1-11(8-14(17)18)9-20-16(23)21-10-13(5-4-12(21)2)15(22)19-6-7-24-3/h11-14H,4-10H2,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | SMUVHLUOZYTMRD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|