C19H22N2O3 — CID 167822387
N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-morpholin-4-ylaniline (PubChem CID 167822387) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-morpholin-4-ylaniline.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 167822387 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-morpholin-4-ylaniline |
| SMILES | CC(Nc1cccc(N2CCOCC2)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H22N2O3/c1-14(15-5-6-18-19(11-15)24-13-23-18)20-16-3-2-4-17(12-16)21-7-9-22-10-8-21/h2-6,11-12,14,20H,7-10,13H2,1H3 |
| InChIKey | KQSSMUMOMYCQQO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |