C15H20N2O4 — CID 167822885
5-[(4-hydroxyoxan-4-yl)methoxy]-1,3-dimethylbenzimidazol-2-one (PubChem CID 167822885) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is 5-[(4-hydroxyoxan-4-yl)methoxy]-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-[(4-hydroxyoxan-4-yl)methoxy]-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 167822885 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 5-[(4-hydroxyoxan-4-yl)methoxy]-1,3-dimethylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc(OCC3(O)CCOCC3)ccc21 |
| InChI | InChI=1S/C15H20N2O4/c1-16-12-4-3-11(9-13(12)17(2)14(16)18)21-10-15(19)5-7-20-8-6-15/h3-4,9,19H,5-8,10H2,1-2H3 |
| InChIKey | OQZYJLSFRUOWBW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |