C21H28N4O6S2 — CID 167824701
N-[3-[[2-[[(2R,4S)-2-methyloxan-4-yl]sulfamoyl]-4-sulfamoylanilino]methyl]phenyl]acetamide (PubChem CID 167824701) has the molecular formula C21H28N4O6S2 and a molecular weight of 496.61 g/mol. Its IUPAC name is N-[3-[[2-[[(2R,4S)-2-methyloxan-4-yl]sulfamoyl]-4-sulfamoylanilino]methyl]phenyl]acetamide.
| Compound Name | N-[3-[[2-[[(2R,4S)-2-methyloxan-4-yl]sulfamoyl]-4-sulfamoylanilino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 167824701 |
| Molecular Formula | C21H28N4O6S2 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | N-[3-[[2-[[(2R,4S)-2-methyloxan-4-yl]sulfamoyl]-4-sulfamoylanilino]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(CNc2ccc(S(N)(=O)=O)cc2S(=O)(=O)N[C@H]2CCO[C@H](C)C2)c1 |
| InChI | InChI=1S/C21H28N4O6S2/c1-14-10-18(8-9-31-14)25-33(29,30)21-12-19(32(22,27)28)6-7-20(21)23-13-16-4-3-5-17(11-16)24-15(2)26/h3-7,11-12,14,18,23,25H,8-10,13H2,1-2H3,(H,24,26)(H2,22,27,28)/t14-,18+/m1/s1 |
| InChIKey | XAEMVHKGZXCCOV-KDOFPFPSSA-N |
| XLogP | 1.75 |
| TPSA | 156.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |