C21H33N5O4 — CID 167825441
N-tert-butyl-2-[4-[[(2,6-dimethyl-3-nitrophenyl)carbamoylamino]methyl]piperidin-1-yl]acetamide (PubChem CID 167825441) has the molecular formula C21H33N5O4 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[[(2,6-dimethyl-3-nitrophenyl)carbamoylamino]methyl]piperidin-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[4-[[(2,6-dimethyl-3-nitrophenyl)carbamoylamino]methyl]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 167825441 |
| Molecular Formula | C21H33N5O4 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | N-tert-butyl-2-[4-[[(2,6-dimethyl-3-nitrophenyl)carbamoylamino]methyl]piperidin-1-yl]acetamide |
| SMILES | Cc1ccc([N+](=O)[O-])c(C)c1NC(=O)NCC1CCN(CC(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H33N5O4/c1-14-6-7-17(26(29)30)15(2)19(14)23-20(28)22-12-16-8-10-25(11-9-16)13-18(27)24-21(3,4)5/h6-7,16H,8-13H2,1-5H3,(H,24,27)(H2,22,23,28) |
| InChIKey | QLZAXBRJYVWVCH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|