C18H27BrN4O3 — CID 133368808
2-[4-[(5-bromo-2-nitroanilino)methyl]piperidin-1-yl]-N-tert-butylacetamide (PubChem CID 133368808) has the molecular formula C18H27BrN4O3 and a molecular weight of 427.34 g/mol. Its IUPAC name is 2-[4-[(5-bromo-2-nitroanilino)methyl]piperidin-1-yl]-N-tert-butylacetamide.
| Compound Name | 2-[4-[(5-bromo-2-nitroanilino)methyl]piperidin-1-yl]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 133368808 |
| Molecular Formula | C18H27BrN4O3 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 2-[4-[(5-bromo-2-nitroanilino)methyl]piperidin-1-yl]-N-tert-butylacetamide |
| SMILES | CC(C)(C)NC(=O)CN1CCC(CNc2cc(Br)ccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H27BrN4O3/c1-18(2,3)21-17(24)12-22-8-6-13(7-9-22)11-20-15-10-14(19)4-5-16(15)23(25)26/h4-5,10,13,20H,6-9,11-12H2,1-3H3,(H,21,24) |
| InChIKey | NACHZYYCKPKKJB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|