C16H13F3N4 — CID 167827669
4-[3-(3,4,5-trifluorophenyl)pyrrolidin-1-yl]-1H-imidazo[4,5-c]pyridine (PubChem CID 167827669) has the molecular formula C16H13F3N4 and a molecular weight of 318.30 g/mol. Its IUPAC name is 4-[3-(3,4,5-trifluorophenyl)pyrrolidin-1-yl]-1H-imidazo[4,5-c]pyridine.
| Compound Name | 4-[3-(3,4,5-trifluorophenyl)pyrrolidin-1-yl]-1H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 167827669 |
| Molecular Formula | C16H13F3N4 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 4-[3-(3,4,5-trifluorophenyl)pyrrolidin-1-yl]-1H-imidazo[4,5-c]pyridine |
| SMILES | Fc1cc(C2CCN(c3nccc4[nH]cnc34)C2)cc(F)c1F |
| InChI | InChI=1S/C16H13F3N4/c17-11-5-10(6-12(18)14(11)19)9-2-4-23(7-9)16-15-13(1-3-20-16)21-8-22-15/h1,3,5-6,8-9H,2,4,7H2,(H,21,22) |
| InChIKey | IBVPUIVDRSCLGJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|