C16H20ClN5O2 — CID 167828184
2-[4-(2-chloro-5-methoxyphenyl)triazol-1-yl]-1-(2-methylpiperazin-1-yl)ethanone (PubChem CID 167828184) has the molecular formula C16H20ClN5O2 and a molecular weight of 349.82 g/mol. Its IUPAC name is 2-[4-(2-chloro-5-methoxyphenyl)triazol-1-yl]-1-(2-methylpiperazin-1-yl)ethanone.
| Compound Name | 2-[4-(2-chloro-5-methoxyphenyl)triazol-1-yl]-1-(2-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 167828184 |
| Molecular Formula | C16H20ClN5O2 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-[4-(2-chloro-5-methoxyphenyl)triazol-1-yl]-1-(2-methylpiperazin-1-yl)ethanone |
| SMILES | COc1ccc(Cl)c(-c2cn(CC(=O)N3CCNCC3C)nn2)c1 |
| InChI | InChI=1S/C16H20ClN5O2/c1-11-8-18-5-6-22(11)16(23)10-21-9-15(19-20-21)13-7-12(24-2)3-4-14(13)17/h3-4,7,9,11,18H,5-6,8,10H2,1-2H3 |
| InChIKey | KCVWNXRQPZKFHT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |