C34H28N6O5 — CID 167828867
7-nitro-N-[[2-[4-[(2-phenylindol-1-yl)methyl]triazol-1-yl]phenyl]methyl]-3,4-dihydro-2H-1,5-benzodioxepine-8-carboxamide (PubChem CID 167828867) has the molecular formula C34H28N6O5 and a molecular weight of 600.64 g/mol. Its IUPAC name is 7-nitro-N-[[2-[4-[(2-phenylindol-1-yl)methyl]triazol-1-yl]phenyl]methyl]-3,4-dihydro-2H-1,5-benzodioxepine-8-carboxamide.
| Compound Name | 7-nitro-N-[[2-[4-[(2-phenylindol-1-yl)methyl]triazol-1-yl]phenyl]methyl]-3,4-dihydro-2H-1,5-benzodioxepine-8-carboxamide |
|---|---|
| PubChem CID | 167828867 |
| Molecular Formula | C34H28N6O5 |
| Molecular Weight | 600.64 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | 7-nitro-N-[[2-[4-[(2-phenylindol-1-yl)methyl]triazol-1-yl]phenyl]methyl]-3,4-dihydro-2H-1,5-benzodioxepine-8-carboxamide |
| SMILES | O=C(NCc1ccccc1-n1cc(Cn2c(-c3ccccc3)cc3ccccc32)nn1)c1cc2c(cc1[N+](=O)[O-])OCCCO2 |
| InChI | InChI=1S/C34H28N6O5/c41-34(27-18-32-33(19-31(27)40(42)43)45-16-8-15-44-32)35-20-25-12-5-7-14-29(25)39-22-26(36-37-39)21-38-28-13-6-4-11-24(28)17-30(38)23-9-2-1-3-10-23/h1-7,9-14,17-19,22H,8,15-16,20-21H2,(H,35,41) |
| InChIKey | CGSUXZVLZMFALC-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 126.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.64 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|