C20H16N4O6S — CID 26996647
4-methyl-N'-(6-nitro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)-2-phenyl-1,3-thiazole-5-carbohydrazide (PubChem CID 26996647) has the molecular formula C20H16N4O6S and a molecular weight of 440.44 g/mol. Its IUPAC name is 4-methyl-N'-(6-nitro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)-2-phenyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | 4-methyl-N'-(6-nitro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)-2-phenyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 26996647 |
| Molecular Formula | C20H16N4O6S |
| Molecular Weight | 440.44 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 4-methyl-N'-(6-nitro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)-2-phenyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)NNC(=O)c1cc2c(cc1[N+](=O)[O-])OCCO2 |
| InChI | InChI=1S/C20H16N4O6S/c1-11-17(31-20(21-11)12-5-3-2-4-6-12)19(26)23-22-18(25)13-9-15-16(30-8-7-29-15)10-14(13)24(27)28/h2-6,9-10H,7-8H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | KVFUDLIVTSZOSB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|