C18H22N6 — CID 167830431
1-[[3-[[4-(1H-pyrazol-4-yl)triazol-1-yl]methyl]phenyl]methyl]piperidine (PubChem CID 167830431) has the molecular formula C18H22N6 and a molecular weight of 322.42 g/mol. Its IUPAC name is 1-[[3-[[4-(1H-pyrazol-4-yl)triazol-1-yl]methyl]phenyl]methyl]piperidine.
| Compound Name | 1-[[3-[[4-(1H-pyrazol-4-yl)triazol-1-yl]methyl]phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 167830431 |
| Molecular Formula | C18H22N6 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-[[3-[[4-(1H-pyrazol-4-yl)triazol-1-yl]methyl]phenyl]methyl]piperidine |
| SMILES | c1cc(CN2CCCCC2)cc(Cn2cc(-c3cn[nH]c3)nn2)c1 |
| InChI | InChI=1S/C18H22N6/c1-2-7-23(8-3-1)12-15-5-4-6-16(9-15)13-24-14-18(21-22-24)17-10-19-20-11-17/h4-6,9-11,14H,1-3,7-8,12-13H2,(H,19,20) |
| InChIKey | HEBQRLUCRCYKHJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |