C18H19N5 — CID 175938515
2-[[4-[3-(azetidin-1-ylmethyl)phenyl]triazol-1-yl]methyl]pyridine (PubChem CID 175938515) has the molecular formula C18H19N5 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-[[4-[3-(azetidin-1-ylmethyl)phenyl]triazol-1-yl]methyl]pyridine.
| Compound Name | 2-[[4-[3-(azetidin-1-ylmethyl)phenyl]triazol-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 175938515 |
| Molecular Formula | C18H19N5 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-[[4-[3-(azetidin-1-ylmethyl)phenyl]triazol-1-yl]methyl]pyridine |
| SMILES | c1ccc(Cn2cc(-c3cccc(CN4CCC4)c3)nn2)nc1 |
| InChI | InChI=1S/C18H19N5/c1-2-8-19-17(7-1)13-23-14-18(20-21-23)16-6-3-5-15(11-16)12-22-9-4-10-22/h1-3,5-8,11,14H,4,9-10,12-13H2 |
| InChIKey | RFBXQWWIYLOONF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |