About N-[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]-4-pyridin-3-yloxybutanamide
N-[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]-4-pyridin-3-yloxybutanamide (PubChem CID 167832965) has the molecular formula C17H24N2O4
and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]-4-pyridin-3-yloxybutanamide.
Molecular Properties
| Compound Name | N-[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]-4-pyridin-3-yloxybutanamide |
| PubChem CID | 167832965 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]-4-pyridin-3-yloxybutanamide |
| SMILES | O=C(CCCOc1cccnc1)N[C@@H]1C[C@@H](O)C12CCOCC2 |
| InChI | InChI=1S/C17H24N2O4/c20-15-11-14(17(15)5-9-22-10-6-17)19-16(21)4-2-8-23-13-3-1-7-18-12-13/h1,3,7,12,14-15,20H,2,4-6,8-11H2,(H,19,21)/t14-,15-/m1/s1 |
| InChIKey | OHAULBPSMGFJEV-HUUCEWRRSA-N |
| XLogP | 1.29 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]-4-pyridin-3-yloxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]-4-pyridin-3-yloxybutanamide?
The IUPAC name of N-[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]-4-pyridin-3-yloxybutanamide (CID 167832965) is N-[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]-4-pyridin-3-yloxybutanamide.
What is the SMILES notation for N-[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]-4-pyridin-3-yloxybutanamide?
The canonical SMILES for N-[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]-4-pyridin-3-yloxybutanamide is O=C(CCCOc1cccnc1)N[C@@H]1C[C@@H](O)C12CCOCC2.
What is the InChIKey of N-[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]-4-pyridin-3-yloxybutanamide?
The InChIKey is OHAULBPSMGFJEV-HUUCEWRRSA-N. The full InChI is InChI=1S/C17H24N2O4/c20-15-11-14(17(15)5-9-22-10-6-17)19-16(21)4-2-8-23-13-3-1-7-18-12-13/h1,3,7,12,14-15,20H,2,4-6,8-11H2,(H,19,21)/t14-,15-/m1/s1.
What are the key properties of N-[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]-4-pyridin-3-yloxybutanamide?
N-[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]-4-pyridin-3-yloxybutanamide has a molecular weight of 320.39 g/mol, XLogP of 1.29, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]-4-pyridin-3-yloxybutanamide is sourced from PubChem (CID 167832965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).