C17H24N2O4 — CID 167832965
N-[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]-4-pyridin-3-yloxybutanamide (PubChem CID 167832965) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]-4-pyridin-3-yloxybutanamide.
| Compound Name | N-[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]-4-pyridin-3-yloxybutanamide |
|---|---|
| PubChem CID | 167832965 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-[(1R,3R)-3-hydroxy-7-oxaspiro[3.5]nonan-1-yl]-4-pyridin-3-yloxybutanamide |
| SMILES | O=C(CCCOc1cccnc1)N[C@@H]1C[C@@H](O)C12CCOCC2 |
| InChI | InChI=1S/C17H24N2O4/c20-15-11-14(17(15)5-9-22-10-6-17)19-16(21)4-2-8-23-13-3-1-7-18-12-13/h1,3,7,12,14-15,20H,2,4-6,8-11H2,(H,19,21)/t14-,15-/m1/s1 |
| InChIKey | OHAULBPSMGFJEV-HUUCEWRRSA-N |
| XLogP | 1.29 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|