C16H22N2O5 — CID 99784600
methyl 2-[(3R)-3-(4-pyridin-3-yloxybutanoylamino)oxolan-3-yl]acetate (PubChem CID 99784600) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is methyl 2-[(3R)-3-(4-pyridin-3-yloxybutanoylamino)oxolan-3-yl]acetate.
| Compound Name | methyl 2-[(3R)-3-(4-pyridin-3-yloxybutanoylamino)oxolan-3-yl]acetate |
|---|---|
| PubChem CID | 99784600 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | methyl 2-[(3R)-3-(4-pyridin-3-yloxybutanoylamino)oxolan-3-yl]acetate |
| SMILES | COC(=O)C[C@]1(NC(=O)CCCOc2cccnc2)CCOC1 |
| InChI | InChI=1S/C16H22N2O5/c1-21-15(20)10-16(6-9-22-12-16)18-14(19)5-3-8-23-13-4-2-7-17-11-13/h2,4,7,11H,3,5-6,8-10,12H2,1H3,(H,18,19)/t16-/m1/s1 |
| InChIKey | GFXQAAUFBVJHQV-MRXNPFEDSA-N |
| XLogP | 1.08 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|