C19H25NO6 — CID 119214907
2-[4-[4-(4-acetylphenoxy)butanoylamino]oxan-4-yl]acetic acid (PubChem CID 119214907) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is 2-[4-[4-(4-acetylphenoxy)butanoylamino]oxan-4-yl]acetic acid.
| Compound Name | 2-[4-[4-(4-acetylphenoxy)butanoylamino]oxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 119214907 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-[4-[4-(4-acetylphenoxy)butanoylamino]oxan-4-yl]acetic acid |
| SMILES | CC(=O)c1ccc(OCCCC(=O)NC2(CC(=O)O)CCOCC2)cc1 |
| InChI | InChI=1S/C19H25NO6/c1-14(21)15-4-6-16(7-5-15)26-10-2-3-17(22)20-19(13-18(23)24)8-11-25-12-9-19/h4-7H,2-3,8-13H2,1H3,(H,20,22)(H,23,24) |
| InChIKey | ZGAFRXOPCFLDEN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|