C21H24N2O5 — CID 119214636
2-[4-[3-(naphthalene-2-carbonylamino)propanoylamino]oxan-4-yl]acetic acid (PubChem CID 119214636) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is 2-[4-[3-(naphthalene-2-carbonylamino)propanoylamino]oxan-4-yl]acetic acid.
| Compound Name | 2-[4-[3-(naphthalene-2-carbonylamino)propanoylamino]oxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 119214636 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2-[4-[3-(naphthalene-2-carbonylamino)propanoylamino]oxan-4-yl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)CCNC(=O)c2ccc3ccccc3c2)CCOCC1 |
| InChI | InChI=1S/C21H24N2O5/c24-18(23-21(14-19(25)26)8-11-28-12-9-21)7-10-22-20(27)17-6-5-15-3-1-2-4-16(15)13-17/h1-6,13H,7-12,14H2,(H,22,27)(H,23,24)(H,25,26) |
| InChIKey | WTHMIUYNTDOWCT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |