C14H20N2O4S — CID 104630584
N-[3-[[4-(hydroxymethyl)oxan-4-yl]amino]-3-oxopropyl]thiophene-3-carboxamide (PubChem CID 104630584) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is N-[3-[[4-(hydroxymethyl)oxan-4-yl]amino]-3-oxopropyl]thiophene-3-carboxamide.
| Compound Name | N-[3-[[4-(hydroxymethyl)oxan-4-yl]amino]-3-oxopropyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 104630584 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-[3-[[4-(hydroxymethyl)oxan-4-yl]amino]-3-oxopropyl]thiophene-3-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccsc1)NC1(CO)CCOCC1 |
| InChI | InChI=1S/C14H20N2O4S/c17-10-14(3-6-20-7-4-14)16-12(18)1-5-15-13(19)11-2-8-21-9-11/h2,8-9,17H,1,3-7,10H2,(H,15,19)(H,16,18) |
| InChIKey | WCIRADUIRQFMCT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |