C18H25NO6 — CID 119214727
2-[4-[(3,4-diethoxybenzoyl)amino]oxan-4-yl]acetic acid (PubChem CID 119214727) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-[4-[(3,4-diethoxybenzoyl)amino]oxan-4-yl]acetic acid.
| Compound Name | 2-[4-[(3,4-diethoxybenzoyl)amino]oxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 119214727 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 2-[4-[(3,4-diethoxybenzoyl)amino]oxan-4-yl]acetic acid |
| SMILES | CCOc1ccc(C(=O)NC2(CC(=O)O)CCOCC2)cc1OCC |
| InChI | InChI=1S/C18H25NO6/c1-3-24-14-6-5-13(11-15(14)25-4-2)17(22)19-18(12-16(20)21)7-9-23-10-8-18/h5-6,11H,3-4,7-10,12H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | WZSPNNIWKGIVQF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |