C20H19BrClN5O3 — CID 167834271
4-bromo-N-[2-[1-[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]ethylcarbamoylamino]ethyl]benzamide (PubChem CID 167834271) has the molecular formula C20H19BrClN5O3 and a molecular weight of 492.76 g/mol. Its IUPAC name is 4-bromo-N-[2-[1-[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]ethylcarbamoylamino]ethyl]benzamide.
| Compound Name | 4-bromo-N-[2-[1-[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]ethylcarbamoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 167834271 |
| Molecular Formula | C20H19BrClN5O3 |
| Molecular Weight | 492.76 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | 4-bromo-N-[2-[1-[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]ethylcarbamoylamino]ethyl]benzamide |
| SMILES | CC(NC(=O)NCCNC(=O)c1ccc(Br)cc1)c1noc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C20H19BrClN5O3/c1-12(17-26-19(30-27-17)14-4-8-16(22)9-5-14)25-20(29)24-11-10-23-18(28)13-2-6-15(21)7-3-13/h2-9,12H,10-11H2,1H3,(H,23,28)(H2,24,25,29) |
| InChIKey | PYAIVBZUDHEKBK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.76 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|